Products 23255-41-6

CAS 23255-41-6 is the registry number for S-(2-Acetamidoethyl) 3-oxobutanethioate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

S-(2-acetamidoethyl) 3-oxobutanethioate (CAS 23255-41-6) is a chemical compound with the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. IUPAC name: S-(2-acetamidoethyl) 3-oxobutanethioate. InChIKey: JFTGQZKJAXFLDQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13NO3S
Molecular weight203.26 g/mol
IUPAC nameS-(2-acetamidoethyl) 3-oxobutanethioate
InChIKeyJFTGQZKJAXFLDQ-UHFFFAOYSA-N
SMILESCC(=O)CC(=O)SCCNC(=O)C

Computed by PubChem (NCBI)