Products 23294-55-5

CAS 23294-55-5 is the registry number for 4-(2-Hydroxyethoxy)-3-methoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(2-hydroxyethoxy)-3-methoxybenzoic acid (CAS 23294-55-5) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: 4-(2-hydroxyethoxy)-3-methoxybenzoic acid. InChIKey: HKGSNBHTDBKLBU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O5
Molecular weight212.20 g/mol
IUPAC name4-(2-hydroxyethoxy)-3-methoxybenzoic acid
InChIKeyHKGSNBHTDBKLBU-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C(=O)O)OCCO

Computed by PubChem (NCBI)