Products 23386-40-5
CAS 23386-40-5 appears in our catalog under these names: 1-Oxoisoindoline-5-carboxylic acid, 95%, 1-Oxoisoindoline-5-carboxylic acid, 97%, 1-Oxoisoindoline-5-carboxylic Acid, 97%, 97%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
1-oxo-2,3-dihydroisoindole-5-carboxylic acid (CAS 23386-40-5) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 1-oxo-2,3-dihydroisoindole-5-carboxylic acid. InChIKey: OLKKGIPWCIURHH-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-oxo-2,3-dihydroisoindole-5-carboxylic acid |
| InChIKey | OLKKGIPWCIURHH-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)C(=O)O)C(=O)N1 |
Computed by PubChem (NCBI)