CAS 23392-52-1 appears in our catalog under these names: Estradiol Impurity 2 (17beta-delta8,9-Dehydroestradiol), dl-delta8,9-Dehydroestradiol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
(13S,14S,17S)-13-methyl-6,7,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol (CAS 23392-52-1) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: (13S,14S,17S)-13-methyl-6,7,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol. InChIKey: UWYDUSMQFLTKBQ-BZSNNMDCSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | (13S,14S,17S)-13-methyl-6,7,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | UWYDUSMQFLTKBQ-BZSNNMDCSA-N |
| SMILES | C[C@]12CCC3=C([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)O |
Computed by PubChem (NCBI)