CAS 1796929-11-7 is the registry number for Hydroquinone Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(4-propan-2-ylphenyl)propan-2-yl]benzene-1,4-diol (CAS 1796929-11-7) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: 2-[2-(4-propan-2-ylphenyl)propan-2-yl]benzene-1,4-diol. InChIKey: YLJWTKYDKPJNJJ-UHFFFAOYSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 2-[2-(4-propan-2-ylphenyl)propan-2-yl]benzene-1,4-diol |
| InChIKey | YLJWTKYDKPJNJJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(C)(C)C2=C(C=CC(=C2)O)O |
Computed by PubChem (NCBI)