Products 2343964-49-6
CAS 2343964-49-6 is the registry number for (1R)-2-Amino-1-(2,4-difluorophenyl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R)-2-amino-1-(2,4-difluorophenyl)ethanol;hydrochloride (CAS 2343964-49-6) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: (1R)-2-amino-1-(2,4-difluorophenyl)ethanol;hydrochloride. InChIKey: RZAMYLBZAGZDDI-QRPNPIFTSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | (1R)-2-amino-1-(2,4-difluorophenyl)ethanol;hydrochloride |
| InChIKey | RZAMYLBZAGZDDI-QRPNPIFTSA-N |
| SMILES | C1=CC(=C(C=C1F)F)[C@H](CN)O.Cl |
Computed by PubChem (NCBI)