CAS 23464-17-7 is the registry number for Diphenylethanone Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1,3-diphenylpropane-1,2-dione (CAS 23464-17-7) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 1,3-diphenylpropane-1,2-dione. InChIKey: NUDGQVHENFOCFX-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 1,3-diphenylpropane-1,2-dione |
| InChIKey | NUDGQVHENFOCFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)