Products 2347694-79-3
CAS 2347694-79-3 is the registry number for Anti-inflammatory agent 63. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-methoxy-N-(2-methylphenyl)-4-oxochromene-2-carboxamide (CAS 2347694-79-3) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 7-methoxy-N-(2-methylphenyl)-4-oxochromene-2-carboxamide. InChIKey: IZOCGRNWJHZWSL-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 7-methoxy-N-(2-methylphenyl)-4-oxochromene-2-carboxamide |
| InChIKey | IZOCGRNWJHZWSL-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)C2=CC(=O)C3=C(O2)C=C(C=C3)OC |
Computed by PubChem (NCBI)
Synonyms:
Anti-inflammatory agent 63, orb1941721