Products 2358335-28-9
CAS 2358335-28-9 is the registry number for 5-Chloro-α,α-dimethyl-6-(1-methylethoxy)-3-pyridinemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(5-chloro-6-propan-2-yloxy-3-pyridinyl)propan-2-ol (CAS 2358335-28-9) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 2-(5-chloro-6-propan-2-yloxy-3-pyridinyl)propan-2-ol. InChIKey: PUWFHJVHTRLYDI-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | 2-(5-chloro-6-propan-2-yloxy-3-pyridinyl)propan-2-ol |
| InChIKey | PUWFHJVHTRLYDI-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=N1)C(C)(C)O)Cl |
Computed by PubChem (NCBI)