Products 2361643-41-4

CAS 2361643-41-4 is the registry number for 4,4-Dimethyl piperidine-4,4-dicarboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Dimethyl piperidine-4,4-dicarboxylate;hydrochloride (CAS 2361643-41-4) is a chemical compound with the molecular formula C9H16ClNO4 and a molecular weight of 237.68 g/mol. IUPAC name: dimethyl piperidine-4,4-dicarboxylate;hydrochloride. InChIKey: JASRHRJYRMMRKF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClNO4
Molecular weight237.68 g/mol
IUPAC namedimethyl piperidine-4,4-dicarboxylate;hydrochloride
InChIKeyJASRHRJYRMMRKF-UHFFFAOYSA-N
SMILESCOC(=O)C1(CCNCC1)C(=O)OC.Cl

Computed by PubChem (NCBI)