Products 2369048-06-4

CAS 2369048-06-4 is the registry number for Pyruvate Carboxylase-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-hydroxy-3-quinolin-2-ylprop-2-enoic acid (CAS 2369048-06-4) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 2-hydroxy-3-quinolin-2-ylprop-2-enoic acid. InChIKey: PQZOUJKJYOMYQY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9NO3
Molecular weight215.20 g/mol
IUPAC name2-hydroxy-3-quinolin-2-ylprop-2-enoic acid
InChIKeyPQZOUJKJYOMYQY-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC(=N2)C=C(C(=O)O)O

Computed by PubChem (NCBI)

Synonyms: orb2564644