CAS 2369048-06-4 is the registry number for Pyruvate Carboxylase-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-hydroxy-3-quinolin-2-ylprop-2-enoic acid (CAS 2369048-06-4) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 2-hydroxy-3-quinolin-2-ylprop-2-enoic acid. InChIKey: PQZOUJKJYOMYQY-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-hydroxy-3-quinolin-2-ylprop-2-enoic acid |
| InChIKey | PQZOUJKJYOMYQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C=C(C(=O)O)O |
Computed by PubChem (NCBI)