CAS 2375249-51-5 is the registry number for rac-Methyl (1R,4R,6R,7S)-6-hydroxy-2-azabicyclo(2.2.1)heptane-7-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl (1S,4S,6S,7R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-7-carboxylate;hydrochloride (CAS 2375249-51-5) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: methyl (1S,4S,6S,7R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-7-carboxylate;hydrochloride. InChIKey: LWJOFBNIXAEHQW-RAPQHUHKSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | methyl (1S,4S,6S,7R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-7-carboxylate;hydrochloride |
| InChIKey | LWJOFBNIXAEHQW-RAPQHUHKSA-N |
| SMILES | COC(=O)[C@@H]1[C@@H]2C[C@@H]([C@H]1NC2)O.Cl |
Computed by PubChem (NCBI)