Products 2334476-68-3
CAS 2334476-68-3 appears in our catalog under these names: Methyl 4-(hydroxymethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylate hydrochloride, 98%, Methyl 4-(hydroxymethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25mg, 50mg.
Methyl 4-(hydroxymethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylate;hydrochloride (CAS 2334476-68-3) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: methyl 4-(hydroxymethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylate;hydrochloride. InChIKey: KILORAOUIOUXEE-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | methyl 4-(hydroxymethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylate;hydrochloride |
| InChIKey | KILORAOUIOUXEE-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(CN2)CO.Cl |
Computed by PubChem (NCBI)