Products 1895414-50-2

CAS 1895414-50-2 is the registry number for 3-(4-Oxopiperidin-1-yl)propanoic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(4-oxopiperidin-1-yl)propanoic acid;hydrochloride (CAS 1895414-50-2) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: 3-(4-oxopiperidin-1-yl)propanoic acid;hydrochloride. InChIKey: UXEBSJDWWXAPJO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO3
Molecular weight207.65 g/mol
IUPAC name3-(4-oxopiperidin-1-yl)propanoic acid;hydrochloride
InChIKeyUXEBSJDWWXAPJO-UHFFFAOYSA-N
SMILESC1CN(CCC1=O)CCC(=O)O.Cl

Computed by PubChem (NCBI)