CAS 67253-30-9 is the registry number for Chloroac-Ile-OH. Offered by: Creative Peptides. Available pack sizes: 5g, 25g, 100g.
(2S,3S)-2-[(2-chloroacetyl)amino]-3-methylpentanoic acid (CAS 67253-30-9) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: (2S,3S)-2-[(2-chloroacetyl)amino]-3-methylpentanoic acid. InChIKey: HEZNGQNQHGVQLO-FSPLSTOPSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (2S,3S)-2-[(2-chloroacetyl)amino]-3-methylpentanoic acid |
| InChIKey | HEZNGQNQHGVQLO-FSPLSTOPSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC(=O)CCl |
Computed by PubChem (NCBI)