Products 255897-09-7
CAS 255897-09-7 is the registry number for Methyl (1S,3S,4R)-3-hydroxy-7-azabicyclo[2.2.1]heptane-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1S,3S,4R)-3-hydroxy-7-azabicyclo[2.2.1]heptane-1-carboxylate;hydrochloride (CAS 255897-09-7) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: methyl (1S,3S,4R)-3-hydroxy-7-azabicyclo[2.2.1]heptane-1-carboxylate;hydrochloride. InChIKey: QAKFRTPCMGHCMQ-YWHDXUBYSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | methyl (1S,3S,4R)-3-hydroxy-7-azabicyclo[2.2.1]heptane-1-carboxylate;hydrochloride |
| InChIKey | QAKFRTPCMGHCMQ-YWHDXUBYSA-N |
| SMILES | COC(=O)[C@@]12CC[C@@H](N1)[C@H](C2)O.Cl |
Computed by PubChem (NCBI)