CAS 2787516-25-8 is the registry number for Rel-(1S,2S,3R,4R)-Methyl 3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1S,2S,3R,4R)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride (CAS 2787516-25-8) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: methyl (1S,2S,3R,4R)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride. InChIKey: LAFLJVAOWPFONY-MBWJBUSCSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | methyl (1S,2S,3R,4R)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride |
| InChIKey | LAFLJVAOWPFONY-MBWJBUSCSA-N |
| SMILES | COC(=O)[C@@H]1[C@@H]2CC[C@H]([C@@H]1N)O2.Cl |
Computed by PubChem (NCBI)