Products 61435-75-4

CAS 61435-75-4 is the registry number for 6-(2-Chloroacetamido)hexanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-[(2-chloroacetyl)amino]hexanoic acid (CAS 61435-75-4) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: 6-[(2-chloroacetyl)amino]hexanoic acid. InChIKey: XHDKOTBUHPMWRY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO3
Molecular weight207.65 g/mol
IUPAC name6-[(2-chloroacetyl)amino]hexanoic acid
InChIKeyXHDKOTBUHPMWRY-UHFFFAOYSA-N
SMILESC(CCC(=O)O)CCNC(=O)CCl

Computed by PubChem (NCBI)