CAS 4505-16-2 is the registry number for Methyl diexo-3-amino-7-oxa-bicyclo[2.2.1]heptane-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Methyl (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride (CAS 4505-16-2) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: methyl (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride. InChIKey: LAFLJVAOWPFONY-VSLZZJKVSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | methyl (1R,2S,3R,4S)-3-amino-7-oxabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride |
| InChIKey | LAFLJVAOWPFONY-VSLZZJKVSA-N |
| SMILES | COC(=O)[C@@H]1[C@H]2CC[C@@H]([C@@H]1N)O2.Cl |
Computed by PubChem (NCBI)