CAS 23754-45-2 appears in our catalog under these names: 4-(Methylcarbamoyl)benzoic acid, 96%, 4–(Methylcarbamoyl)benzoic acid, 4-[(Methylamino)carbonyl]benzoic acid, 98%, 98%, 4-[(Methylamino)carbonyl]benzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
4-(methylcarbamoyl)benzoic acid (CAS 23754-45-2) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 4-(methylcarbamoyl)benzoic acid. InChIKey: ZYTCRZMJZJPYEG-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 4-(methylcarbamoyl)benzoic acid |
| InChIKey | ZYTCRZMJZJPYEG-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)