CAS 2377030-47-0 is the registry number for (2S)-2-Amino-4-methylhexanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S)-2-amino-4-methylhexanoic acid;hydrochloride (CAS 2377030-47-0) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (2S)-2-amino-4-methylhexanoic acid;hydrochloride. InChIKey: SPQQAYQGFFZOGP-PQAGPIFVSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (2S)-2-amino-4-methylhexanoic acid;hydrochloride |
| InChIKey | SPQQAYQGFFZOGP-PQAGPIFVSA-N |
| SMILES | CCC(C)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)