Products 2377035-35-1
CAS 2377035-35-1 is the registry number for 4-(3,3-Difluorocyclobutyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(3,3-difluorocyclobutyl)aniline;hydrochloride (CAS 2377035-35-1) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: 4-(3,3-difluorocyclobutyl)aniline;hydrochloride. InChIKey: ANKVQZGACCAGLC-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 4-(3,3-difluorocyclobutyl)aniline;hydrochloride |
| InChIKey | ANKVQZGACCAGLC-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)