Products 2378501-41-6
CAS 2378501-41-6 is the registry number for 3-(3,3-Difluorocyclobutyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3,3-difluorocyclobutyl)aniline;hydrochloride (CAS 2378501-41-6) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: 3-(3,3-difluorocyclobutyl)aniline;hydrochloride. InChIKey: TWXOVMPWMXUXJN-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 3-(3,3-difluorocyclobutyl)aniline;hydrochloride |
| InChIKey | TWXOVMPWMXUXJN-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)