Products 23789-34-6
CAS 23789-34-6 appears in our catalog under these names: Alpha-furil dioxime, 95%, (Z,Z)-a-Furil Dioxime, >95% (HPLC), (Z,Z)-Alpha-Furil Dioxime, >95% (HPLC), α–Furil Dioxime, alpha-Furil Dioxime, >97.0%(W)(HPLC). Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 100mg, 10mg, 50mg, 250mg.
(NZ)-N-[(2Z)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine (CAS 23789-34-6) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: (NZ)-N-[(2Z)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine. InChIKey: RBOZTFPIXJBLPK-WGDLNXRISA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | (NZ)-N-[(2Z)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine |
| InChIKey | RBOZTFPIXJBLPK-WGDLNXRISA-N |
| SMILES | C1=COC(=C1)/C(=N\O)/C(=N/O)/C2=CC=CO2 |
Computed by PubChem (NCBI)