CAS 32856-95-4 is the registry number for 3-(4-Nitrophenyl)pyrrolidine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(4-nitrophenyl)pyrrolidine-2,5-dione (CAS 32856-95-4) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 3-(4-nitrophenyl)pyrrolidine-2,5-dione. InChIKey: VKYZMMHTCHOLHQ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 3-(4-nitrophenyl)pyrrolidine-2,5-dione |
| InChIKey | VKYZMMHTCHOLHQ-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC1=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)