Products 109175-09-9
CAS 109175-09-9 appears in our catalog under these names: 6-Nitro-1h-indole-3-carboxylic acid methyl ester, 95%, 6-Nitro-1H-indole-3-carboxylic acid methyl ester, 96%, 96%, Methyl 6-nitroindole-3-carboxylate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 10g.
Methyl 6-nitro-1H-indole-3-carboxylate (CAS 109175-09-9) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: methyl 6-nitro-1H-indole-3-carboxylate. InChIKey: RUUDKWNUIUBVTH-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | methyl 6-nitro-1H-indole-3-carboxylate |
| InChIKey | RUUDKWNUIUBVTH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)