CAS 885522-60-1 appears in our catalog under these names: 6-(Methoxycarbonyl)-1h-indazole-3-carboxylic acid, 95%, 6–(Methoxycarbonyl)–1H–indazole–3–carboxylic acid, 6-(Methoxycarbonyl)-1H-indazole-3-carboxylic acid, 97%, 97%, 6-(Methoxycarbonyl)-1H-indazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
6-methoxycarbonyl-1H-indazole-3-carboxylic acid (CAS 885522-60-1) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 6-methoxycarbonyl-1H-indazole-3-carboxylic acid. InChIKey: AZTKLZPDTBASOO-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 6-methoxycarbonyl-1H-indazole-3-carboxylic acid |
| InChIKey | AZTKLZPDTBASOO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)