CAS 898747-36-9 is the registry number for 7-(Methoxycarbonyl)-1H-indazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 50mg.
7-methoxycarbonyl-2H-indazole-3-carboxylic acid (CAS 898747-36-9) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 7-methoxycarbonyl-2H-indazole-3-carboxylic acid. InChIKey: OXAGXNBNFPFDPF-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 7-methoxycarbonyl-2H-indazole-3-carboxylic acid |
| InChIKey | OXAGXNBNFPFDPF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C(NN=C21)C(=O)O |
Computed by PubChem (NCBI)