Products 898747-36-9

CAS 898747-36-9 is the registry number for 7-(Methoxycarbonyl)-1H-indazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 50mg.

Structural formula: {0} (CAS {1})

7-methoxycarbonyl-2H-indazole-3-carboxylic acid (CAS 898747-36-9) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 7-methoxycarbonyl-2H-indazole-3-carboxylic acid. InChIKey: OXAGXNBNFPFDPF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8N2O4
Molecular weight220.18 g/mol
IUPAC name7-methoxycarbonyl-2H-indazole-3-carboxylic acid
InChIKeyOXAGXNBNFPFDPF-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC2=C(NN=C21)C(=O)O

Computed by PubChem (NCBI)