CAS 195985-12-7 appears in our catalog under these names: 3,4-Dihydro-1h-1,4-benzodiazepine-2,5-dione, 96%, 2,5-Dioxo-2,3,4,5-tetrahydro-1H-benzo(e)(1,4)diazepine-8-carboxylic acid, 98%, 8-carboxylic-3h-1,4-benzodiazepin-2,5-(1h,4h)-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 25g, 0,5g.
2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepine-8-carboxylic acid (CAS 195985-12-7) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepine-8-carboxylic acid. InChIKey: RFGPIJJAGNRBBJ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepine-8-carboxylic acid |
| InChIKey | RFGPIJJAGNRBBJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=CC(=C2)C(=O)O)C(=O)N1 |
Computed by PubChem (NCBI)