Products 321162-58-7
CAS 321162-58-7 appears in our catalog under these names: Ethyl 4-cyano-3-nitrobenzoate, 95%, Ethyl 4-cyano-3-nitrobenzoate, 98+%, Ethyl 4-cyano-3-nitrobenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 100g, 10g, 5g, 50g.
Ethyl 4-cyano-3-nitrobenzoate (CAS 321162-58-7) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: ethyl 4-cyano-3-nitrobenzoate. InChIKey: MGNXPEPCKZZLQP-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | ethyl 4-cyano-3-nitrobenzoate |
| InChIKey | MGNXPEPCKZZLQP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)