Products 2380645-52-1
CAS 2380645-52-1 is the registry number for (S)-4-Chloro-6-fluoro-2,3-dihydro-1H-inden-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-4-chloro-6-fluoro-2,3-dihydro-1H-inden-1-ol (CAS 2380645-52-1) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: (1S)-4-chloro-6-fluoro-2,3-dihydro-1H-inden-1-ol. InChIKey: NBVSJZQEQQHGHT-VIFPVBQESA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | (1S)-4-chloro-6-fluoro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | NBVSJZQEQQHGHT-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@H]1O)C=C(C=C2Cl)F |
Computed by PubChem (NCBI)