CAS 23827-17-0 appears in our catalog under these names: Phenazopyridine Impurity 6, 2,6-Didesamino-2-hydroxy-6-oxo Phenazopyridine. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
6-hydroxy-5-phenyldiazenyl-1H-pyridin-2-one (CAS 23827-17-0) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 6-hydroxy-5-phenyldiazenyl-1H-pyridin-2-one. InChIKey: UCDZMNCEQOYDGS-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 6-hydroxy-5-phenyldiazenyl-1H-pyridin-2-one |
| InChIKey | UCDZMNCEQOYDGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=C(NC(=O)C=C2)O |
Computed by PubChem (NCBI)