CAS 2383351-78-6 is the registry number for 3-Bromopyrazolo[1,5-c]pyrimidine-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromopyrazolo[1,5-c]pyrimidine-5-carboxylic acid (CAS 2383351-78-6) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 3-bromopyrazolo[1,5-c]pyrimidine-5-carboxylic acid. InChIKey: HUJWREIKQIHSKA-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 3-bromopyrazolo[1,5-c]pyrimidine-5-carboxylic acid |
| InChIKey | HUJWREIKQIHSKA-UHFFFAOYSA-N |
| SMILES | C1=C(N=CN2C1=C(C=N2)Br)C(=O)O |
Computed by PubChem (NCBI)