Products 2384009-45-2
CAS 2384009-45-2 is the registry number for 3-oxabicyclo[3.1.1]heptane-1,5-dicarboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
3-oxabicyclo[3.1.1]heptane-1,5-dicarboxylic acid (CAS 2384009-45-2) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 3-oxabicyclo[3.1.1]heptane-1,5-dicarboxylic acid. InChIKey: HNZACNNLHPLTOO-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 3-oxabicyclo[3.1.1]heptane-1,5-dicarboxylic acid |
| InChIKey | HNZACNNLHPLTOO-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(COC2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)