CAS 2386-33-6 appears in our catalog under these names: 3-Acetyl-4,5-dimethyl-1h-pyrrole-2-carboxylic acid, 95%, 3-Acetyl-4,5-dimethyl-1H-pyrrole-2-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-acetyl-4,5-dimethyl-1H-pyrrole-2-carboxylic acid (CAS 2386-33-6) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 3-acetyl-4,5-dimethyl-1H-pyrrole-2-carboxylic acid. InChIKey: PPSGKMWFWAXDHT-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 3-acetyl-4,5-dimethyl-1H-pyrrole-2-carboxylic acid |
| InChIKey | PPSGKMWFWAXDHT-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1C(=O)C)C(=O)O)C |
Computed by PubChem (NCBI)