Products 2386295-35-6
CAS 2386295-35-6 appears in our catalog under these names: 5-Bromoimidazo[1,2-a]pyrazine-2-carboxylic acid, 95%, 5–Bromoimidazo(1，2–a)pyrazine–2–carboxylic acid, 5-Bromoimidazo[1,2-a]Pyrazine-2-Carboxylic Acid, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
5-bromoimidazo[1,2-a]pyrazine-2-carboxylic acid (CAS 2386295-35-6) is a chemical compound with the molecular formula C7H4BrN3O2 and a molecular weight of 242.03 g/mol. IUPAC name: 5-bromoimidazo[1,2-a]pyrazine-2-carboxylic acid. InChIKey: IKKCOTLWTTTWGH-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O2 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | 5-bromoimidazo[1,2-a]pyrazine-2-carboxylic acid |
| InChIKey | IKKCOTLWTTTWGH-UHFFFAOYSA-N |
| SMILES | C1=C(N2C=C(N=C2C=N1)C(=O)O)Br |
Computed by PubChem (NCBI)