Products 2387595-96-0
CAS 2387595-96-0 is the registry number for Methyl 7,7-difluoro-4,5,6,7-tetrahydro-1H-indole-2-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 7,7-difluoro-1,4,5,6-tetrahydroindole-2-carboxylate (CAS 2387595-96-0) is a chemical compound with the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. IUPAC name: methyl 7,7-difluoro-1,4,5,6-tetrahydroindole-2-carboxylate. InChIKey: CFKFQOYZYJEFIV-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO2 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | methyl 7,7-difluoro-1,4,5,6-tetrahydroindole-2-carboxylate |
| InChIKey | CFKFQOYZYJEFIV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C(CCC2)(F)F |
Computed by PubChem (NCBI)