Products 2387597-32-0
CAS 2387597-32-0 is the registry number for 3,3-Dimethyl-2,3-dihydroimidazo[1,5-a]pyridine-1,5-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-dimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione (CAS 2387597-32-0) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 3,3-dimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione. InChIKey: MCKLILKLCURBBO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 3,3-dimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione |
| InChIKey | MCKLILKLCURBBO-UHFFFAOYSA-N |
| SMILES | CC1(NC(=O)C2=CC=CC(=O)N21)C |
Computed by PubChem (NCBI)