Products 2387920-11-6
CAS 2387920-11-6 is the registry number for 2-(1-(Methoxycarbonyl)-5,6,7,8-tetrahydroindolizin-3-yl)-2-oxoacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-methoxycarbonyl-5,6,7,8-tetrahydroindolizin-3-yl)-2-oxoacetic acid (CAS 2387920-11-6) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 2-(1-methoxycarbonyl-5,6,7,8-tetrahydroindolizin-3-yl)-2-oxoacetic acid. InChIKey: CRDMQGRXTNYBCA-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 2-(1-methoxycarbonyl-5,6,7,8-tetrahydroindolizin-3-yl)-2-oxoacetic acid |
| InChIKey | CRDMQGRXTNYBCA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CCCCN2C(=C1)C(=O)C(=O)O |
Computed by PubChem (NCBI)