CAS 239087-08-2 appears in our catalog under these names: 2–Fluoro–6–(trifluoromethyl)benzyl bromide, 2-Fluoro-6-(trifluoromethyl)benzyl bromide, 95%, 2-Fluoro-6-(trifluoromethyl)benzyl bromide, 98%, 2-Fluoro-6-(trifluoromethyl)benzyl Bromide, >98.0%(GC), 2-(Bromomethyl)-1-fluoro-3-(trifluoromethyl)benzene, 98%. Offered by: GLPBio, Thermo Scientific (Acros), Fluorochem, TCI, Ambeed. Available pack sizes: 5g, 10g, 25g, 1g, 100g.
2-(bromomethyl)-1-fluoro-3-(trifluoromethyl)benzene (CAS 239087-08-2) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 2-(bromomethyl)-1-fluoro-3-(trifluoromethyl)benzene. InChIKey: RINUERVPFANASB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 2-(bromomethyl)-1-fluoro-3-(trifluoromethyl)benzene |
| InChIKey | RINUERVPFANASB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CBr)C(F)(F)F |
Computed by PubChem (NCBI)