CAS 239087-09-3 appears in our catalog under these names: 3–Fluoro–5–(trifluoromethyl)benzyl bromide, 3-Fluoro-5-(trifluoromethyl)benzyl bromide, 3-Fluoro-5-(trifluoromethyl)benzyl bromide, 98%, 3-Fluoro-5-(trifluoromethyl)benzyl Bromide, >98.0%(GC), 1-(Bromomethyl)-3-Fluoro-5-(Trifluoromethyl)Benzene, 97%, 97%. Offered by: GLPBio, Biosynth, Fluorochem, TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 50g, 100g, 250mg, 10g, 15g.
1-(bromomethyl)-3-fluoro-5-(trifluoromethyl)benzene (CAS 239087-09-3) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 1-(bromomethyl)-3-fluoro-5-(trifluoromethyl)benzene. InChIKey: LCVWAXYGYMZJER-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 1-(bromomethyl)-3-fluoro-5-(trifluoromethyl)benzene |
| InChIKey | LCVWAXYGYMZJER-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)F)CBr |
Computed by PubChem (NCBI)