Products 2393-28-4
CAS 2393-28-4 appears in our catalog under these names: 2-(4-Carbamoylphenyl)acetic acid, 2-(4-carbamoylphenyl)acetic acid, 97%, 2-(4-Carbamoylphenyl)acetic acid, 95%, 2-(4-Carbamoylphenyl)acetic acid, 95%, 95%. Offered by: Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g.
2-(4-carbamoylphenyl)acetic acid (CAS 2393-28-4) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 2-(4-carbamoylphenyl)acetic acid. InChIKey: ZGWAEKSJTSFZSS-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 2-(4-carbamoylphenyl)acetic acid |
| InChIKey | ZGWAEKSJTSFZSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)C(=O)N |
Computed by PubChem (NCBI)