CAS 24036-52-0 appears in our catalog under these names: 6-Bromo-2H-1,4-benzoxazin-3(4H)-one, 6–Bromo–2H–1,4–benzoxazin–3(4H)–one, 6-Bromo-2H-1,4-benzoxazin-3(4H)-one, 95% , 6-Bromo-2H-1,4-benzoxazin-3(4H)-one, >94.0%(GC), 6-Bromo-2H-1,4-benzoxazin-3(4H)-one, 98%, 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100g.
6-bromo-4H-1,4-benzoxazin-3-one (CAS 24036-52-0) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 6-bromo-4H-1,4-benzoxazin-3-one. InChIKey: UQCFMEFQBSYDHY-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 6-bromo-4H-1,4-benzoxazin-3-one |
| InChIKey | UQCFMEFQBSYDHY-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)Br |
Computed by PubChem (NCBI)