CAS 24036-63-3 appears in our catalog under these names: 1-Phenyl-1h-1,2,4-triazole-3-carboxylic acid, 95%, 1-Phenyl-1H-1,2,4-triazole-3-carboxylic acid, 98%, 98%, 1-Phenyl-1H-1,2,4-triazole-3-carboxylic acid, 97%, 1-Phenyl-1H-1,2,4-triazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
1-phenyl-1,2,4-triazole-3-carboxylic acid (CAS 24036-63-3) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 1-phenyl-1,2,4-triazole-3-carboxylic acid. InChIKey: ACFQGTMTFLDFLP-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 1-phenyl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | ACFQGTMTFLDFLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC(=N2)C(=O)O |
Computed by PubChem (NCBI)