Products 2407426-99-5
CAS 2407426-99-5 is the registry number for 3-Ethyl-2,6-dimethoxybenzenesulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-ethyl-2,6-dimethoxybenzenesulfonic acid (CAS 2407426-99-5) is a chemical compound with the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. IUPAC name: 3-ethyl-2,6-dimethoxybenzenesulfonic acid. InChIKey: KPEXZRFORIBRLJ-UHFFFAOYSA-N.
| Molecular formula | C10H14O5S |
|---|---|
| Molecular weight | 246.28 g/mol |
| IUPAC name | 3-ethyl-2,6-dimethoxybenzenesulfonic acid |
| InChIKey | KPEXZRFORIBRLJ-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C=C1)OC)S(=O)(=O)O)OC |
Computed by PubChem (NCBI)