CAS 41274-09-3 is the registry number for (R)-1-Tosyloxy-2,3-propanediol. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
[(2R)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate (CAS 41274-09-3) is a chemical compound with the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. IUPAC name: [(2R)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate. InChIKey: DFQNMODTAFTGHS-SECBINFHSA-N.
| Molecular formula | C10H14O5S |
|---|---|
| Molecular weight | 246.28 g/mol |
| IUPAC name | [(2R)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate |
| InChIKey | DFQNMODTAFTGHS-SECBINFHSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H](CO)O |
Computed by PubChem (NCBI)