CAS 50765-70-3 appears in our catalog under these names: (S)-1-Tosyloxy-2,3-propanediol, (S)-2,3-Dihydroxypropyl 4-methylbenzenesulfonate 98%, (S)-2,3-Dihydroxypropyl 4-methylbenzenesulfonate, 98%, 98%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
[(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate (CAS 50765-70-3) is a chemical compound with the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. IUPAC name: [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate. InChIKey: DFQNMODTAFTGHS-VIFPVBQESA-N.
| Molecular formula | C10H14O5S |
|---|---|
| Molecular weight | 246.28 g/mol |
| IUPAC name | [(2S)-2,3-dihydroxypropyl] 4-methylbenzenesulfonate |
| InChIKey | DFQNMODTAFTGHS-VIFPVBQESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H](CO)O |
Computed by PubChem (NCBI)