CAS 73413-79-3 appears in our catalog under these names: ((1S,4S)-7,7-Dimethyl-2,3-dioxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid, 97%, Camphorquinone-10-sulfonic Acid Hydrate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g, 1g.
[(1S,4S)-7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (CAS 73413-79-3) is a chemical compound with the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. IUPAC name: [(1S,4S)-7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid. InChIKey: VQHWAOZYKVGMQX-LHLIQPBNSA-N.
| Molecular formula | C10H14O5S |
|---|---|
| Molecular weight | 246.28 g/mol |
| IUPAC name | [(1S,4S)-7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| InChIKey | VQHWAOZYKVGMQX-LHLIQPBNSA-N |
| SMILES | CC1([C@@H]2CC[C@]1(C(=O)C2=O)CS(=O)(=O)O)C |
Computed by PubChem (NCBI)