CAS 928623-32-9 is the registry number for (R,S)-1-Tosyl Glycerol-d5. Offered by: TRC. Available pack sizes: 50mg, 5mg.
(1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) 4-methylbenzenesulfonate (CAS 928623-32-9) is a chemical compound with the molecular formula C10H14O5S and a molecular weight of 251.31 g/mol. IUPAC name: (1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) 4-methylbenzenesulfonate. InChIKey: DFQNMODTAFTGHS-PTSIOIPUSA-N.
| Molecular formula | C10H14O5S |
|---|---|
| Molecular weight | 251.31 g/mol |
| IUPAC name | (1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) 4-methylbenzenesulfonate |
| InChIKey | DFQNMODTAFTGHS-PTSIOIPUSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OS(=O)(=O)C1=CC=C(C=C1)C)O)O |
Computed by PubChem (NCBI)