Products 73684-56-7

CAS 73684-56-7 is the registry number for 1,3-dihydroxypropan-2-yl 4-methylbenzenesulfonate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,3-dihydroxypropan-2-yl 4-methylbenzenesulfonate (CAS 73684-56-7) is a chemical compound with the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. IUPAC name: 1,3-dihydroxypropan-2-yl 4-methylbenzenesulfonate. InChIKey: MOYBWQXXNJRRHU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14O5S
Molecular weight246.28 g/mol
IUPAC name1,3-dihydroxypropan-2-yl 4-methylbenzenesulfonate
InChIKeyMOYBWQXXNJRRHU-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OC(CO)CO

Computed by PubChem (NCBI)